C11H24BN3O4 — CID 155541393
(3R,4S)-3-amino-1-[(2S)-2-aminopropyl]-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid (PubChem CID 155541393) has the molecular formula C11H24BN3O4 and a molecular weight of 273.14 g/mol. Its IUPAC name is (3R,4S)-3-amino-1-[(2S)-2-aminopropyl]-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid.
| Compound Name | (3R,4S)-3-amino-1-[(2S)-2-aminopropyl]-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 155541393 |
| Molecular Formula | C11H24BN3O4 |
| Molecular Weight | 273.14 g/mol |
| Exact Mass | 273.19 |
| IUPAC Name | (3R,4S)-3-amino-1-[(2S)-2-aminopropyl]-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid |
| SMILES | C[C@H](N)CN1C[C@H](CCCB(O)O)[C@](N)(C(=O)O)C1 |
| InChI | InChI=1S/C11H24BN3O4/c1-8(13)5-15-6-9(3-2-4-12(18)19)11(14,7-15)10(16)17/h8-9,18-19H,2-7,13-14H2,1H3,(H,16,17)/t8-,9-,11-/m0/s1 |
| InChIKey | NRUYFUDQNNLGKO-QXEWZRGKSA-N |
| XLogP | -1.70 |
| TPSA | 133.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.14 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|