C8H17BN2O4 — CID 151892128
(2S,3R,4R)-4-amino-3-(3-boronopropyl)pyrrolidine-2-carboxylic acid (PubChem CID 151892128) has the molecular formula C8H17BN2O4 and a molecular weight of 216.05 g/mol. Its IUPAC name is (2S,3R,4R)-4-amino-3-(3-boronopropyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2S,3R,4R)-4-amino-3-(3-boronopropyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 151892128 |
| Molecular Formula | C8H17BN2O4 |
| Molecular Weight | 216.05 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | (2S,3R,4R)-4-amino-3-(3-boronopropyl)pyrrolidine-2-carboxylic acid |
| SMILES | N[C@H]1CN[C@H](C(=O)O)[C@@H]1CCCB(O)O |
| InChI | InChI=1S/C8H17BN2O4/c10-6-4-11-7(8(12)13)5(6)2-1-3-9(14)15/h5-7,11,14-15H,1-4,10H2,(H,12,13)/t5-,6+,7+/m1/s1 |
| InChIKey | SQYICQFLEQDQHO-VQVTYTSYSA-N |
| XLogP | -1.76 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.05 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|