C9H17BO4 — CID 69054314
(2S)-2-(3-boronopropyl)cyclopentane-1-carboxylic acid (PubChem CID 69054314) has the molecular formula C9H17BO4 and a molecular weight of 200.04 g/mol. Its IUPAC name is (2S)-2-(3-boronopropyl)cyclopentane-1-carboxylic acid.
| Compound Name | (2S)-2-(3-boronopropyl)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 69054314 |
| Molecular Formula | C9H17BO4 |
| Molecular Weight | 200.04 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | (2S)-2-(3-boronopropyl)cyclopentane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC[C@@H]1CCCB(O)O |
| InChI | InChI=1S/C9H17BO4/c11-9(12)8-5-1-3-7(8)4-2-6-10(13)14/h7-8,13-14H,1-6H2,(H,11,12)/t7-,8?/m1/s1 |
| InChIKey | LAEMEXSHYYYITG-GVHYBUMESA-N |
| XLogP | 0.74 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.04 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|