C11H21BN2O5 — CID 145304739
1-(2-aminopropanoyl)-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid (PubChem CID 145304739) has the molecular formula C11H21BN2O5 and a molecular weight of 272.11 g/mol. Its IUPAC name is 1-(2-aminopropanoyl)-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 1-(2-aminopropanoyl)-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 145304739 |
| Molecular Formula | C11H21BN2O5 |
| Molecular Weight | 272.11 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 1-(2-aminopropanoyl)-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid |
| SMILES | CC(N)C(=O)N1CC(CCCB(O)O)C(C(=O)O)C1 |
| InChI | InChI=1S/C11H21BN2O5/c1-7(13)10(15)14-5-8(3-2-4-12(18)19)9(6-14)11(16)17/h7-9,18-19H,2-6,13H2,1H3,(H,16,17) |
| InChIKey | ODMKDXVIDWJDMC-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 124.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.11 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|