C10H16N2O5 — CID 113353831
1-[(2R)-2-aminopropanoyl]piperidine-3,4-dicarboxylic acid (PubChem CID 113353831) has the molecular formula C10H16N2O5 and a molecular weight of 244.25 g/mol. Its IUPAC name is 1-[(2R)-2-aminopropanoyl]piperidine-3,4-dicarboxylic acid.
| Compound Name | 1-[(2R)-2-aminopropanoyl]piperidine-3,4-dicarboxylic acid |
|---|---|
| PubChem CID | 113353831 |
| Molecular Formula | C10H16N2O5 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 1-[(2R)-2-aminopropanoyl]piperidine-3,4-dicarboxylic acid |
| SMILES | C[C@@H](N)C(=O)N1CCC(C(=O)O)C(C(=O)O)C1 |
| InChI | InChI=1S/C10H16N2O5/c1-5(11)8(13)12-3-2-6(9(14)15)7(4-12)10(16)17/h5-7H,2-4,11H2,1H3,(H,14,15)(H,16,17)/t5-,6?,7?/m1/s1 |
| InChIKey | BCHVQGSSMBSGSO-GRQBKTHUSA-N |
| XLogP | -1.03 |
| TPSA | 120.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |