C11H22N2O — CID 130747616
(2R)-2-amino-1-(3,5-dimethylazepan-1-yl)propan-1-one (PubChem CID 130747616) has the molecular formula C11H22N2O and a molecular weight of 198.31 g/mol. Its IUPAC name is (2R)-2-amino-1-(3,5-dimethylazepan-1-yl)propan-1-one.
| Compound Name | (2R)-2-amino-1-(3,5-dimethylazepan-1-yl)propan-1-one |
|---|---|
| PubChem CID | 130747616 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | (2R)-2-amino-1-(3,5-dimethylazepan-1-yl)propan-1-one |
| SMILES | CC1CCN(C(=O)[C@@H](C)N)CC(C)C1 |
| InChI | InChI=1S/C11H22N2O/c1-8-4-5-13(7-9(2)6-8)11(14)10(3)12/h8-10H,4-7,12H2,1-3H3/t8?,9?,10-/m1/s1 |
| InChIKey | PNNVCBNETXHYNC-UDNWOFFPSA-N |
| XLogP | 1.23 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |