C12H20N2O5 — CID 112568092
1-(4-aminopentanoyl)piperidine-3,4-dicarboxylic acid (PubChem CID 112568092) has the molecular formula C12H20N2O5 and a molecular weight of 272.30 g/mol. Its IUPAC name is 1-(4-aminopentanoyl)piperidine-3,4-dicarboxylic acid.
| Compound Name | 1-(4-aminopentanoyl)piperidine-3,4-dicarboxylic acid |
|---|---|
| PubChem CID | 112568092 |
| Molecular Formula | C12H20N2O5 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 1-(4-aminopentanoyl)piperidine-3,4-dicarboxylic acid |
| SMILES | CC(N)CCC(=O)N1CCC(C(=O)O)C(C(=O)O)C1 |
| InChI | InChI=1S/C12H20N2O5/c1-7(13)2-3-10(15)14-5-4-8(11(16)17)9(6-14)12(18)19/h7-9H,2-6,13H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | QWINQXPDGRCFEO-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 120.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |