C14H24N2O5 — CID 115918606
1-[3-(tert-butylamino)propanoyl]piperidine-3,4-dicarboxylic acid (PubChem CID 115918606) has the molecular formula C14H24N2O5 and a molecular weight of 300.35 g/mol. Its IUPAC name is 1-[3-(tert-butylamino)propanoyl]piperidine-3,4-dicarboxylic acid.
| Compound Name | 1-[3-(tert-butylamino)propanoyl]piperidine-3,4-dicarboxylic acid |
|---|---|
| PubChem CID | 115918606 |
| Molecular Formula | C14H24N2O5 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | 1-[3-(tert-butylamino)propanoyl]piperidine-3,4-dicarboxylic acid |
| SMILES | CC(C)(C)NCCC(=O)N1CCC(C(=O)O)C(C(=O)O)C1 |
| InChI | InChI=1S/C14H24N2O5/c1-14(2,3)15-6-4-11(17)16-7-5-9(12(18)19)10(8-16)13(20)21/h9-10,15H,4-8H2,1-3H3,(H,18,19)(H,20,21) |
| InChIKey | HPHBLWROHAVXAX-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |