C12H19NO6 — CID 107938324
1-(2-propoxyacetyl)piperidine-3,4-dicarboxylic acid (PubChem CID 107938324) has the molecular formula C12H19NO6 and a molecular weight of 273.28 g/mol. Its IUPAC name is 1-(2-propoxyacetyl)piperidine-3,4-dicarboxylic acid.
| Compound Name | 1-(2-propoxyacetyl)piperidine-3,4-dicarboxylic acid |
|---|---|
| PubChem CID | 107938324 |
| Molecular Formula | C12H19NO6 |
| Molecular Weight | 273.28 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 1-(2-propoxyacetyl)piperidine-3,4-dicarboxylic acid |
| SMILES | CCCOCC(=O)N1CCC(C(=O)O)C(C(=O)O)C1 |
| InChI | InChI=1S/C12H19NO6/c1-2-5-19-7-10(14)13-4-3-8(11(15)16)9(6-13)12(17)18/h8-9H,2-7H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | VUYNYNMWJPQJQI-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.28 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|