C13H23NO4 — CID 120952187
(3S,4S)-4-methyl-1-(2-pentoxyacetyl)pyrrolidine-3-carboxylic acid (PubChem CID 120952187) has the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. Its IUPAC name is (3S,4S)-4-methyl-1-(2-pentoxyacetyl)pyrrolidine-3-carboxylic acid.
| Compound Name | (3S,4S)-4-methyl-1-(2-pentoxyacetyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 120952187 |
| Molecular Formula | C13H23NO4 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | (3S,4S)-4-methyl-1-(2-pentoxyacetyl)pyrrolidine-3-carboxylic acid |
| SMILES | CCCCCOCC(=O)N1C[C@@H](C)[C@H](C(=O)O)C1 |
| InChI | InChI=1S/C13H23NO4/c1-3-4-5-6-18-9-12(15)14-7-10(2)11(8-14)13(16)17/h10-11H,3-9H2,1-2H3,(H,16,17)/t10-,11-/m1/s1 |
| InChIKey | PVTYEORPZLHEEJ-GHMZBOCLSA-N |
| XLogP | 1.37 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|