C14H28BN3O6S — CID 154673222
1-[azetidin-3-yl(propan-2-yl)sulfamoyl]-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid (PubChem CID 154673222) has the molecular formula C14H28BN3O6S and a molecular weight of 377.27 g/mol. Its IUPAC name is 1-[azetidin-3-yl(propan-2-yl)sulfamoyl]-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 1-[azetidin-3-yl(propan-2-yl)sulfamoyl]-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 154673222 |
| Molecular Formula | C14H28BN3O6S |
| Molecular Weight | 377.27 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | 1-[azetidin-3-yl(propan-2-yl)sulfamoyl]-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid |
| SMILES | CC(C)N(C1CNC1)S(=O)(=O)N1CC(CCCB(O)O)C(C(=O)O)C1 |
| InChI | InChI=1S/C14H28BN3O6S/c1-10(2)18(12-6-16-7-12)25(23,24)17-8-11(4-3-5-15(21)22)13(9-17)14(19)20/h10-13,16,21-22H,3-9H2,1-2H3,(H,19,20) |
| InChIKey | UFKMOVZVXOHECB-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 130.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.27 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|