C15H36BN5O4S — CID 164837860
3-[(3S,4R)-4-amino-1-[bis[2-(dimethylamino)ethyl]sulfamoyl]pyrrolidin-3-yl]propylboronic acid (PubChem CID 164837860) has the molecular formula C15H36BN5O4S and a molecular weight of 393.36 g/mol. Its IUPAC name is 3-[(3S,4R)-4-amino-1-[bis[2-(dimethylamino)ethyl]sulfamoyl]pyrrolidin-3-yl]propylboronic acid.
| Compound Name | 3-[(3S,4R)-4-amino-1-[bis[2-(dimethylamino)ethyl]sulfamoyl]pyrrolidin-3-yl]propylboronic acid |
|---|---|
| PubChem CID | 164837860 |
| Molecular Formula | C15H36BN5O4S |
| Molecular Weight | 393.36 g/mol |
| Exact Mass | 393.26 |
| IUPAC Name | 3-[(3S,4R)-4-amino-1-[bis[2-(dimethylamino)ethyl]sulfamoyl]pyrrolidin-3-yl]propylboronic acid |
| SMILES | CN(C)CCN(CCN(C)C)S(=O)(=O)N1C[C@H](CCCB(O)O)[C@@H](N)C1 |
| InChI | InChI=1S/C15H36BN5O4S/c1-18(2)8-10-20(11-9-19(3)4)26(24,25)21-12-14(15(17)13-21)6-5-7-16(22)23/h14-15,22-23H,5-13,17H2,1-4H3/t14-,15-/m0/s1 |
| InChIKey | HPTITLXLARTFKD-GJZGRUSLSA-N |
| XLogP | -1.83 |
| TPSA | 113.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.36 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|