C15H35BN4O4S — CID 167579848
3-[(3S,4R)-4-amino-1-[butyl-[2-(dimethylamino)ethyl]sulfamoyl]pyrrolidin-3-yl]propylboronic acid (PubChem CID 167579848) has the molecular formula C15H35BN4O4S and a molecular weight of 378.35 g/mol. Its IUPAC name is 3-[(3S,4R)-4-amino-1-[butyl-[2-(dimethylamino)ethyl]sulfamoyl]pyrrolidin-3-yl]propylboronic acid.
| Compound Name | 3-[(3S,4R)-4-amino-1-[butyl-[2-(dimethylamino)ethyl]sulfamoyl]pyrrolidin-3-yl]propylboronic acid |
|---|---|
| PubChem CID | 167579848 |
| Molecular Formula | C15H35BN4O4S |
| Molecular Weight | 378.35 g/mol |
| Exact Mass | 378.25 |
| IUPAC Name | 3-[(3S,4R)-4-amino-1-[butyl-[2-(dimethylamino)ethyl]sulfamoyl]pyrrolidin-3-yl]propylboronic acid |
| SMILES | CCCCN(CCN(C)C)S(=O)(=O)N1C[C@H](CCCB(O)O)[C@@H](N)C1 |
| InChI | InChI=1S/C15H35BN4O4S/c1-4-5-9-19(11-10-18(2)3)25(23,24)20-12-14(15(17)13-20)7-6-8-16(21)22/h14-15,21-22H,4-13,17H2,1-3H3/t14-,15-/m0/s1 |
| InChIKey | PIHPMHLCDJQDAQ-GJZGRUSLSA-N |
| XLogP | -0.59 |
| TPSA | 110.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.35 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|