C8H20BN3O5S — CID 164837551
3-[(3S,4R)-4-amino-1-(methoxysulfamoyl)pyrrolidin-3-yl]propylboronic acid (PubChem CID 164837551) has the molecular formula C8H20BN3O5S and a molecular weight of 281.14 g/mol. Its IUPAC name is 3-[(3S,4R)-4-amino-1-(methoxysulfamoyl)pyrrolidin-3-yl]propylboronic acid.
| Compound Name | 3-[(3S,4R)-4-amino-1-(methoxysulfamoyl)pyrrolidin-3-yl]propylboronic acid |
|---|---|
| PubChem CID | 164837551 |
| Molecular Formula | C8H20BN3O5S |
| Molecular Weight | 281.14 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 3-[(3S,4R)-4-amino-1-(methoxysulfamoyl)pyrrolidin-3-yl]propylboronic acid |
| SMILES | CONS(=O)(=O)N1C[C@H](CCCB(O)O)[C@@H](N)C1 |
| InChI | InChI=1S/C8H20BN3O5S/c1-17-11-18(15,16)12-5-7(8(10)6-12)3-2-4-9(13)14/h7-8,11,13-14H,2-6,10H2,1H3/t7-,8-/m0/s1 |
| InChIKey | HCEXNROLBOBXJD-YUMQZZPRSA-N |
| XLogP | -2.11 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.14 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|