C9H23BN4O4S — CID 164837482
3-[(3S,4R)-4-amino-1-[(2-amino-1,1-dideuterioethyl)sulfamoyl]pyrrolidin-3-yl]propylboronic acid (PubChem CID 164837482) has the molecular formula C9H23BN4O4S and a molecular weight of 296.20 g/mol. Its IUPAC name is 3-[(3S,4R)-4-amino-1-[(2-amino-1,1-dideuterioethyl)sulfamoyl]pyrrolidin-3-yl]propylboronic acid.
| Compound Name | 3-[(3S,4R)-4-amino-1-[(2-amino-1,1-dideuterioethyl)sulfamoyl]pyrrolidin-3-yl]propylboronic acid |
|---|---|
| PubChem CID | 164837482 |
| Molecular Formula | C9H23BN4O4S |
| Molecular Weight | 296.20 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 3-[(3S,4R)-4-amino-1-[(2-amino-1,1-dideuterioethyl)sulfamoyl]pyrrolidin-3-yl]propylboronic acid |
| SMILES | [2H]C([2H])(CN)NS(=O)(=O)N1C[C@H](CCCB(O)O)[C@@H](N)C1 |
| InChI | InChI=1S/C9H23BN4O4S/c11-4-5-13-19(17,18)14-6-8(9(12)7-14)2-1-3-10(15)16/h8-9,13,15-16H,1-7,11-12H2/t8-,9-/m0/s1/i5D2 |
| InChIKey | DCJBORQBINDHNF-ZQLXVZQHSA-N |
| XLogP | -2.71 |
| TPSA | 141.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.20 |
| LogP ≤ 5 | -2.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|