C15H30BN3O6S — CID 154673218
1-[azetidin-3-yl(butyl)sulfamoyl]-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid (PubChem CID 154673218) has the molecular formula C15H30BN3O6S and a molecular weight of 391.30 g/mol. Its IUPAC name is 1-[azetidin-3-yl(butyl)sulfamoyl]-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 1-[azetidin-3-yl(butyl)sulfamoyl]-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 154673218 |
| Molecular Formula | C15H30BN3O6S |
| Molecular Weight | 391.30 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 1-[azetidin-3-yl(butyl)sulfamoyl]-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid |
| SMILES | CCCCN(C1CNC1)S(=O)(=O)N1CC(CCCB(O)O)C(C(=O)O)C1 |
| InChI | InChI=1S/C15H30BN3O6S/c1-2-3-7-19(13-8-17-9-13)26(24,25)18-10-12(5-4-6-16(22)23)14(11-18)15(20)21/h12-14,17,22-23H,2-11H2,1H3,(H,20,21) |
| InChIKey | ZDZOSMIWDCMCHE-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 130.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.30 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|