C14H26BNO5 — CID 145304728
(3S,4R)-4-(3-boronopropyl)-1-(3,3-dimethylbutanoyl)pyrrolidine-3-carboxylic acid (PubChem CID 145304728) has the molecular formula C14H26BNO5 and a molecular weight of 299.18 g/mol. Its IUPAC name is (3S,4R)-4-(3-boronopropyl)-1-(3,3-dimethylbutanoyl)pyrrolidine-3-carboxylic acid.
| Compound Name | (3S,4R)-4-(3-boronopropyl)-1-(3,3-dimethylbutanoyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 145304728 |
| Molecular Formula | C14H26BNO5 |
| Molecular Weight | 299.18 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | (3S,4R)-4-(3-boronopropyl)-1-(3,3-dimethylbutanoyl)pyrrolidine-3-carboxylic acid |
| SMILES | CC(C)(C)CC(=O)N1C[C@H](CCCB(O)O)[C@H](C(=O)O)C1 |
| InChI | InChI=1S/C14H26BNO5/c1-14(2,3)7-12(17)16-8-10(5-4-6-15(20)21)11(9-16)13(18)19/h10-11,20-21H,4-9H2,1-3H3,(H,18,19)/t10-,11+/m0/s1 |
| InChIKey | XJMVOHCCMCEUNT-WDEREUQCSA-N |
| XLogP | 0.83 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.18 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|