C13H23BN2O7 — CID 145304748
(3S,4R)-1-(2-amino-4-carboxybutanoyl)-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid (PubChem CID 145304748) has the molecular formula C13H23BN2O7 and a molecular weight of 330.15 g/mol. Its IUPAC name is (3S,4R)-1-(2-amino-4-carboxybutanoyl)-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid.
| Compound Name | (3S,4R)-1-(2-amino-4-carboxybutanoyl)-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 145304748 |
| Molecular Formula | C13H23BN2O7 |
| Molecular Weight | 330.15 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | (3S,4R)-1-(2-amino-4-carboxybutanoyl)-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid |
| SMILES | NC(CCC(=O)O)C(=O)N1C[C@H](CCCB(O)O)[C@H](C(=O)O)C1 |
| InChI | InChI=1S/C13H23BN2O7/c15-10(3-4-11(17)18)12(19)16-6-8(2-1-5-14(22)23)9(7-16)13(20)21/h8-10,22-23H,1-7,15H2,(H,17,18)(H,20,21)/t8-,9+,10?/m0/s1 |
| InChIKey | HVXCWJGJTBNKKQ-QIIDTADFSA-N |
| XLogP | -1.41 |
| TPSA | 161.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.15 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|