C16H31BF2N4O6S — CID 164837401
(3R,4S)-3-amino-4-(3-boronopropyl)-1-[(5,5-difluoropiperidin-3-yl)-propan-2-ylsulfamoyl]pyrrolidine-3-carboxylic acid (PubChem CID 164837401) has the molecular formula C16H31BF2N4O6S and a molecular weight of 456.32 g/mol. Its IUPAC name is (3R,4S)-3-amino-4-(3-boronopropyl)-1-[(5,5-difluoropiperidin-3-yl)-propan-2-ylsulfamoyl]pyrrolidine-3-carboxylic acid.
| Compound Name | (3R,4S)-3-amino-4-(3-boronopropyl)-1-[(5,5-difluoropiperidin-3-yl)-propan-2-ylsulfamoyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 164837401 |
| Molecular Formula | C16H31BF2N4O6S |
| Molecular Weight | 456.32 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | (3R,4S)-3-amino-4-(3-boronopropyl)-1-[(5,5-difluoropiperidin-3-yl)-propan-2-ylsulfamoyl]pyrrolidine-3-carboxylic acid |
| SMILES | CC(C)N(C1CNCC(F)(F)C1)S(=O)(=O)N1C[C@H](CCCB(O)O)[C@](N)(C(=O)O)C1 |
| InChI | InChI=1S/C16H31BF2N4O6S/c1-11(2)23(13-6-15(18,19)9-21-7-13)30(28,29)22-8-12(4-3-5-17(26)27)16(20,10-22)14(24)25/h11-13,21,26-27H,3-10,20H2,1-2H3,(H,24,25)/t12-,13?,16-/m0/s1 |
| InChIKey | NPCGIWIHJUBCDA-BSBHGOPBSA-N |
| XLogP | -1.09 |
| TPSA | 156.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.32 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|