About (2R,5S)-2-(3-boronopropyl)-1,4-diazocane-5-carboxylic acid
(2R,5S)-2-(3-boronopropyl)-1,4-diazocane-5-carboxylic acid (PubChem CID 174137011) has the molecular formula C10H21BN2O4
and a molecular weight of 244.10 g/mol. Its IUPAC name is (2R,5S)-2-(3-boronopropyl)-1,4-diazocane-5-carboxylic acid.
Molecular Properties
| Compound Name | (2R,5S)-2-(3-boronopropyl)-1,4-diazocane-5-carboxylic acid |
| PubChem CID | 174137011 |
| Molecular Formula | C10H21BN2O4 |
| Molecular Weight | 244.10 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | (2R,5S)-2-(3-boronopropyl)-1,4-diazocane-5-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCN[C@H](CCCB(O)O)CN1 |
| InChI | InChI=1S/C10H21BN2O4/c14-10(15)9-4-2-6-12-8(7-13-9)3-1-5-11(16)17/h8-9,12-13,16-17H,1-7H2,(H,14,15)/t8-,9+/m1/s1 |
| InChIKey | AGGBJWKJBHLDRR-BDAKNGLRSA-N |
| XLogP | -0.97 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.10 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2R,5S)-2-(3-boronopropyl)-1,4-diazocane-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,5S)-2-(3-boronopropyl)-1,4-diazocane-5-carboxylic acid?
The IUPAC name of (2R,5S)-2-(3-boronopropyl)-1,4-diazocane-5-carboxylic acid (CID 174137011) is (2R,5S)-2-(3-boronopropyl)-1,4-diazocane-5-carboxylic acid.
What is the SMILES notation for (2R,5S)-2-(3-boronopropyl)-1,4-diazocane-5-carboxylic acid?
The canonical SMILES for (2R,5S)-2-(3-boronopropyl)-1,4-diazocane-5-carboxylic acid is O=C(O)[C@@H]1CCCN[C@H](CCCB(O)O)CN1.
What is the InChIKey of (2R,5S)-2-(3-boronopropyl)-1,4-diazocane-5-carboxylic acid?
The InChIKey is AGGBJWKJBHLDRR-BDAKNGLRSA-N. The full InChI is InChI=1S/C10H21BN2O4/c14-10(15)9-4-2-6-12-8(7-13-9)3-1-5-11(16)17/h8-9,12-13,16-17H,1-7H2,(H,14,15)/t8-,9+/m1/s1.
What are the key properties of (2R,5S)-2-(3-boronopropyl)-1,4-diazocane-5-carboxylic acid?
(2R,5S)-2-(3-boronopropyl)-1,4-diazocane-5-carboxylic acid has a molecular weight of 244.10 g/mol, XLogP of -0.97, 5 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,5S)-2-(3-boronopropyl)-1,4-diazocane-5-carboxylic acid is sourced from PubChem (CID 174137011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).