About nitroxyl;(2S)-pyrrolidine-2-carboxylic acid
nitroxyl;(2S)-pyrrolidine-2-carboxylic acid (PubChem CID 145376752) has the molecular formula C5H10N2O3
and a molecular weight of 146.15 g/mol. Its IUPAC name is nitroxyl;(2S)-pyrrolidine-2-carboxylic acid.
Molecular Properties
| Compound Name | nitroxyl;(2S)-pyrrolidine-2-carboxylic acid |
| PubChem CID | 145376752 |
| Molecular Formula | C5H10N2O3 |
| Molecular Weight | 146.15 g/mol |
| Exact Mass | 146.07 |
| IUPAC Name | nitroxyl;(2S)-pyrrolidine-2-carboxylic acid |
| SMILES | N=O.O=C(O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C5H9NO2.HNO/c7-5(8)4-2-1-3-6-4;1-2/h4,6H,1-3H2,(H,7,8);1H/t4-;/m0./s1 |
| InChIKey | MPPYLBDBVQAPRQ-WCCKRBBISA-N |
| XLogP | 0.15 |
| TPSA | 90.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.15 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze nitroxyl;(2S)-pyrrolidine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nitroxyl;(2S)-pyrrolidine-2-carboxylic acid?
The IUPAC name of nitroxyl;(2S)-pyrrolidine-2-carboxylic acid (CID 145376752) is nitroxyl;(2S)-pyrrolidine-2-carboxylic acid.
What is the SMILES notation for nitroxyl;(2S)-pyrrolidine-2-carboxylic acid?
The canonical SMILES for nitroxyl;(2S)-pyrrolidine-2-carboxylic acid is N=O.O=C(O)[C@@H]1CCCN1.
What is the InChIKey of nitroxyl;(2S)-pyrrolidine-2-carboxylic acid?
The InChIKey is MPPYLBDBVQAPRQ-WCCKRBBISA-N. The full InChI is InChI=1S/C5H9NO2.HNO/c7-5(8)4-2-1-3-6-4;1-2/h4,6H,1-3H2,(H,7,8);1H/t4-;/m0./s1.
What are the key properties of nitroxyl;(2S)-pyrrolidine-2-carboxylic acid?
nitroxyl;(2S)-pyrrolidine-2-carboxylic acid has a molecular weight of 146.15 g/mol, XLogP of 0.15, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for nitroxyl;(2S)-pyrrolidine-2-carboxylic acid is sourced from PubChem (CID 145376752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).