(2S,3R,4S)-4-amino-3-hydroxypyrrolidine-2-carboxylic acid

C5H10N2O3 — CID 11744767

IUPAC(2S,3R,4S)-4-amino-3-hydroxypyrrolidine-2-carboxylic acid
SMILESN[C@H]1CN[C@H](C(=O)O)[C@@H]1O
InChIInChI=1S/C5H10N2O3/c6-2-1-7-3(4(2)8)5(9)10/h2-4,7-8H,1,6H2,(H,9,10)/t2-,3-,4+/m0/s1
InChIKeyGYHVXZXKXZOKPS-YVZJFKFKSA-N
MW146.15 g/mol
LogP-2.27
Rot. Bonds1

About (2S,3R,4S)-4-amino-3-hydroxypyrrolidine-2-carboxylic acid

(2S,3R,4S)-4-amino-3-hydroxypyrrolidine-2-carboxylic acid (PubChem CID 11744767) has the molecular formula C5H10N2O3 and a molecular weight of 146.15 g/mol. Its IUPAC name is (2S,3R,4S)-4-amino-3-hydroxypyrrolidine-2-carboxylic acid.

Molecular Properties

Compound Name(2S,3R,4S)-4-amino-3-hydroxypyrrolidine-2-carboxylic acid
PubChem CID11744767
Molecular FormulaC5H10N2O3
Molecular Weight146.15 g/mol
Exact Mass146.07
IUPAC Name(2S,3R,4S)-4-amino-3-hydroxypyrrolidine-2-carboxylic acid
SMILESN[C@H]1CN[C@H](C(=O)O)[C@@H]1O
InChIInChI=1S/C5H10N2O3/c6-2-1-7-3(4(2)8)5(9)10/h2-4,7-8H,1,6H2,(H,9,10)/t2-,3-,4+/m0/s1
InChIKeyGYHVXZXKXZOKPS-YVZJFKFKSA-N
XLogP-2.27
TPSA95.58 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500146.15
LogP ≤ 5-2.27
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Analyze (2S,3R,4S)-4-amino-3-hydroxypyrrolidine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S,3R,4S)-4-amino-3-hydroxypyrrolidine-2-carboxylic acid?
The IUPAC name of (2S,3R,4S)-4-amino-3-hydroxypyrrolidine-2-carboxylic acid (CID 11744767) is (2S,3R,4S)-4-amino-3-hydroxypyrrolidine-2-carboxylic acid.
What is the SMILES notation for (2S,3R,4S)-4-amino-3-hydroxypyrrolidine-2-carboxylic acid?
The canonical SMILES for (2S,3R,4S)-4-amino-3-hydroxypyrrolidine-2-carboxylic acid is N[C@H]1CN[C@H](C(=O)O)[C@@H]1O.
What is the InChIKey of (2S,3R,4S)-4-amino-3-hydroxypyrrolidine-2-carboxylic acid?
The InChIKey is GYHVXZXKXZOKPS-YVZJFKFKSA-N. The full InChI is InChI=1S/C5H10N2O3/c6-2-1-7-3(4(2)8)5(9)10/h2-4,7-8H,1,6H2,(H,9,10)/t2-,3-,4+/m0/s1.
What are the key properties of (2S,3R,4S)-4-amino-3-hydroxypyrrolidine-2-carboxylic acid?
(2S,3R,4S)-4-amino-3-hydroxypyrrolidine-2-carboxylic acid has a molecular weight of 146.15 g/mol, XLogP of -2.27, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3R,4S)-4-amino-3-hydroxypyrrolidine-2-carboxylic acid is sourced from PubChem (CID 11744767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).