C10H21BN2O4 — CID 150886950
(2S,3S,4R)-3-(3-boronopropyl)-4-(dimethylamino)pyrrolidine-2-carboxylic acid (PubChem CID 150886950) has the molecular formula C10H21BN2O4 and a molecular weight of 244.10 g/mol. Its IUPAC name is (2S,3S,4R)-3-(3-boronopropyl)-4-(dimethylamino)pyrrolidine-2-carboxylic acid.
| Compound Name | (2S,3S,4R)-3-(3-boronopropyl)-4-(dimethylamino)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 150886950 |
| Molecular Formula | C10H21BN2O4 |
| Molecular Weight | 244.10 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | (2S,3S,4R)-3-(3-boronopropyl)-4-(dimethylamino)pyrrolidine-2-carboxylic acid |
| SMILES | CN(C)[C@H]1CN[C@H](C(=O)O)[C@@H]1CCCB(O)O |
| InChI | InChI=1S/C10H21BN2O4/c1-13(2)8-6-12-9(10(14)15)7(8)4-3-5-11(16)17/h7-9,12,16-17H,3-6H2,1-2H3,(H,14,15)/t7-,8+,9+/m1/s1 |
| InChIKey | KXFFCSCKVJVGMO-VGMNWLOBSA-N |
| XLogP | -1.16 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.10 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|