C11H22BN3O5 — CID 147314553
(2S,3R,4R)-4-[[(2S)-2-aminopropanoyl]amino]-3-(3-boronopropyl)pyrrolidine-2-carboxylic acid (PubChem CID 147314553) has the molecular formula C11H22BN3O5 and a molecular weight of 287.12 g/mol. Its IUPAC name is (2S,3R,4R)-4-[[(2S)-2-aminopropanoyl]amino]-3-(3-boronopropyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2S,3R,4R)-4-[[(2S)-2-aminopropanoyl]amino]-3-(3-boronopropyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 147314553 |
| Molecular Formula | C11H22BN3O5 |
| Molecular Weight | 287.12 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | (2S,3R,4R)-4-[[(2S)-2-aminopropanoyl]amino]-3-(3-boronopropyl)pyrrolidine-2-carboxylic acid |
| SMILES | C[C@H](N)C(=O)N[C@H]1CN[C@H](C(=O)O)[C@@H]1CCCB(O)O |
| InChI | InChI=1S/C11H22BN3O5/c1-6(13)10(16)15-8-5-14-9(11(17)18)7(8)3-2-4-12(19)20/h6-9,14,19-20H,2-5,13H2,1H3,(H,15,16)(H,17,18)/t6-,7+,8-,9-/m0/s1 |
| InChIKey | CYPMCSPJGHKSDK-KZVJFYERSA-N |
| XLogP | -2.26 |
| TPSA | 144.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.12 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|