C9H19BN2O4 — CID 151845994
(2R,4R)-4-amino-2-(4-boronobutyl)pyrrolidine-2-carboxylic acid (PubChem CID 151845994) has the molecular formula C9H19BN2O4 and a molecular weight of 230.07 g/mol. Its IUPAC name is (2R,4R)-4-amino-2-(4-boronobutyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2R,4R)-4-amino-2-(4-boronobutyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 151845994 |
| Molecular Formula | C9H19BN2O4 |
| Molecular Weight | 230.07 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | (2R,4R)-4-amino-2-(4-boronobutyl)pyrrolidine-2-carboxylic acid |
| SMILES | N[C@H]1CN[C@@](CCCCB(O)O)(C(=O)O)C1 |
| InChI | InChI=1S/C9H19BN2O4/c11-7-5-9(8(13)14,12-6-7)3-1-2-4-10(15)16/h7,12,15-16H,1-6,11H2,(H,13,14)/t7-,9-/m1/s1 |
| InChIKey | SHQWTXRBVVLSOY-VXNVDRBHSA-N |
| XLogP | -1.23 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.07 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|