C14H30BN3O4 — CID 57331482
(3R,4S)-3-amino-4-(3-boronopropyl)-1-[2-(diethylamino)ethyl]pyrrolidine-3-carboxylic acid (PubChem CID 57331482) has the molecular formula C14H30BN3O4 and a molecular weight of 315.22 g/mol. Its IUPAC name is (3R,4S)-3-amino-4-(3-boronopropyl)-1-[2-(diethylamino)ethyl]pyrrolidine-3-carboxylic acid.
| Compound Name | (3R,4S)-3-amino-4-(3-boronopropyl)-1-[2-(diethylamino)ethyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 57331482 |
| Molecular Formula | C14H30BN3O4 |
| Molecular Weight | 315.22 g/mol |
| Exact Mass | 315.23 |
| IUPAC Name | (3R,4S)-3-amino-4-(3-boronopropyl)-1-[2-(diethylamino)ethyl]pyrrolidine-3-carboxylic acid |
| SMILES | CCN(CC)CCN1C[C@H](CCCB(O)O)[C@](N)(C(=O)O)C1 |
| InChI | InChI=1S/C14H30BN3O4/c1-3-17(4-2)8-9-18-10-12(6-5-7-15(21)22)14(16,11-18)13(19)20/h12,21-22H,3-11,16H2,1-2H3,(H,19,20)/t12-,14-/m0/s1 |
| InChIKey | APLAVBPRRARDIY-JSGCOSHPSA-N |
| XLogP | -0.70 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.22 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|