C10H20BN5O5 — CID 158892011
(3R,4S)-3-amino-4-(3-boronopropyl)-1-(diaminomethylidenecarbamoyl)pyrrolidine-3-carboxylic acid (PubChem CID 158892011) has the molecular formula C10H20BN5O5 and a molecular weight of 301.11 g/mol. Its IUPAC name is (3R,4S)-3-amino-4-(3-boronopropyl)-1-(diaminomethylidenecarbamoyl)pyrrolidine-3-carboxylic acid.
| Compound Name | (3R,4S)-3-amino-4-(3-boronopropyl)-1-(diaminomethylidenecarbamoyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 158892011 |
| Molecular Formula | C10H20BN5O5 |
| Molecular Weight | 301.11 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | (3R,4S)-3-amino-4-(3-boronopropyl)-1-(diaminomethylidenecarbamoyl)pyrrolidine-3-carboxylic acid |
| SMILES | NC(N)=NC(=O)N1C[C@H](CCCB(O)O)[C@](N)(C(=O)O)C1 |
| InChI | InChI=1S/C10H20BN5O5/c12-8(13)15-9(19)16-4-6(2-1-3-11(20)21)10(14,5-16)7(17)18/h6,20-21H,1-5,14H2,(H,17,18)(H4,12,13,15,19)/t6-,10-/m0/s1 |
| InChIKey | JEIYDPMXDYRRTG-WKEGUHRASA-N |
| XLogP | -2.65 |
| TPSA | 188.49 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.11 |
| LogP ≤ 5 | -2.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|