C17H27BN4O11S — CID 155627395
(3R,4S)-3-amino-1-[(2-aminocyclopropyl)sulfamoyl]-4-[3-[4,4-bis(carboxymethyl)-5-oxo-1,3,2-dioxaborolan-2-yl]propyl]pyrrolidine-3-carboxylic acid (PubChem CID 155627395) has the molecular formula C17H27BN4O11S and a molecular weight of 506.30 g/mol. Its IUPAC name is (3R,4S)-3-amino-1-[(2-aminocyclopropyl)sulfamoyl]-4-[3-[4,4-bis(carboxymethyl)-5-oxo-1,3,2-dioxaborolan-2-yl]propyl]pyrrolidine-3-carboxylic acid.
| Compound Name | (3R,4S)-3-amino-1-[(2-aminocyclopropyl)sulfamoyl]-4-[3-[4,4-bis(carboxymethyl)-5-oxo-1,3,2-dioxaborolan-2-yl]propyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 155627395 |
| Molecular Formula | C17H27BN4O11S |
| Molecular Weight | 506.30 g/mol |
| Exact Mass | 506.15 |
| IUPAC Name | (3R,4S)-3-amino-1-[(2-aminocyclopropyl)sulfamoyl]-4-[3-[4,4-bis(carboxymethyl)-5-oxo-1,3,2-dioxaborolan-2-yl]propyl]pyrrolidine-3-carboxylic acid |
| SMILES | NC1CC1NS(=O)(=O)N1C[C@H](CCCB2OC(=O)C(CC(=O)O)(CC(=O)O)O2)[C@](N)(C(=O)O)C1 |
| InChI | InChI=1S/C17H27BN4O11S/c19-10-4-11(10)21-34(30,31)22-7-9(17(20,8-22)14(27)28)2-1-3-18-32-15(29)16(33-18,5-12(23)24)6-13(25)26/h9-11,21H,1-8,19-20H2,(H,23,24)(H,25,26)(H,27,28)/t9-,10?,11?,17-/m0/s1 |
| InChIKey | BXPSDCJGTOVWJD-FHCGWTLGSA-N |
| XLogP | -2.84 |
| TPSA | 248.88 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.30 |
| LogP ≤ 5 | -2.84 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|