C21H37BN4O6S — CID 155627323
(3R,4S)-3-amino-1-[(2-aminocyclopropyl)sulfamoyl]-4-[3-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]pyrrolidine-3-carboxylic acid (PubChem CID 155627323) has the molecular formula C21H37BN4O6S and a molecular weight of 484.43 g/mol. Its IUPAC name is (3R,4S)-3-amino-1-[(2-aminocyclopropyl)sulfamoyl]-4-[3-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]pyrrolidine-3-carboxylic acid.
| Compound Name | (3R,4S)-3-amino-1-[(2-aminocyclopropyl)sulfamoyl]-4-[3-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 155627323 |
| Molecular Formula | C21H37BN4O6S |
| Molecular Weight | 484.43 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | (3R,4S)-3-amino-1-[(2-aminocyclopropyl)sulfamoyl]-4-[3-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]pyrrolidine-3-carboxylic acid |
| SMILES | CC1(C)[C@H]2C[C@@H]3OB(CCC[C@H]4CN(S(=O)(=O)NC5CC5N)C[C@@]4(N)C(=O)O)O[C@]3(C)[C@@H]1C2 |
| InChI | InChI=1S/C21H37BN4O6S/c1-19(2)13-7-16(19)20(3)17(8-13)31-22(32-20)6-4-5-12-10-26(11-21(12,24)18(27)28)33(29,30)25-15-9-14(15)23/h12-17,25H,4-11,23-24H2,1-3H3,(H,27,28)/t12-,13+,14?,15?,16+,17-,20+,21-/m0/s1 |
| InChIKey | XGBWEADLJDKOPP-SZGLYTLKSA-N |
| XLogP | 0.14 |
| TPSA | 157.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.43 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|