C18H30BNO4 — CID 155793309
(2S,3R)-3-[3-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]pyrrolidine-2-carboxylic acid (PubChem CID 155793309) has the molecular formula C18H30BNO4 and a molecular weight of 335.25 g/mol. Its IUPAC name is (2S,3R)-3-[3-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S,3R)-3-[3-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 155793309 |
| Molecular Formula | C18H30BNO4 |
| Molecular Weight | 335.25 g/mol |
| Exact Mass | 335.23 |
| IUPAC Name | (2S,3R)-3-[3-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]pyrrolidine-2-carboxylic acid |
| SMILES | CC1(C)[C@H]2C[C@@H]3OB(CCC[C@@H]4CCN[C@@H]4C(=O)O)O[C@]3(C)[C@@H]1C2 |
| InChI | InChI=1S/C18H30BNO4/c1-17(2)12-9-13(17)18(3)14(10-12)23-19(24-18)7-4-5-11-6-8-20-15(11)16(21)22/h11-15,20H,4-10H2,1-3H3,(H,21,22)/t11-,12-,13-,14+,15+,18-/m1/s1 |
| InChIKey | PQVGZKQJEARAKD-MQUBADLTSA-N |
| XLogP | 2.56 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.25 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|