C17H29BO3 — CID 149483739
4,4-dimethyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pentan-3-one (PubChem CID 149483739) has the molecular formula C17H29BO3 and a molecular weight of 292.23 g/mol. Its IUPAC name is 4,4-dimethyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pentan-3-one.
| Compound Name | 4,4-dimethyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pentan-3-one |
|---|---|
| PubChem CID | 149483739 |
| Molecular Formula | C17H29BO3 |
| Molecular Weight | 292.23 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 4,4-dimethyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pentan-3-one |
| SMILES | CC(C)(C)C(=O)CCB1O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C17H29BO3/c1-15(2,3)13(19)7-8-18-20-14-10-11-9-12(16(11,4)5)17(14,6)21-18/h11-12,14H,7-10H2,1-6H3/t11-,12-,14+,17-/m0/s1 |
| InChIKey | ZDTNWRNENIXUTR-DIGLBZAJSA-N |
| XLogP | 3.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.23 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|