C14H25BO3 — CID 143786473
4-[(2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butan-1-ol (PubChem CID 143786473) has the molecular formula C14H25BO3 and a molecular weight of 252.16 g/mol. Its IUPAC name is 4-[(2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butan-1-ol.
| Compound Name | 4-[(2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butan-1-ol |
|---|---|
| PubChem CID | 143786473 |
| Molecular Formula | C14H25BO3 |
| Molecular Weight | 252.16 g/mol |
| Exact Mass | 252.19 |
| IUPAC Name | 4-[(2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butan-1-ol |
| SMILES | CC1(C)C2C[C@H]1CC1OB(CCCCO)O[C@]12C |
| InChI | InChI=1S/C14H25BO3/c1-13(2)10-8-11(13)14(3)12(9-10)17-15(18-14)6-4-5-7-16/h10-12,16H,4-9H2,1-3H3/t10-,11?,12?,14-/m0/s1 |
| InChIKey | ZIMISJPDDHQJQW-BBCYWQGDSA-N |
| XLogP | 2.49 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.16 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|