C19H32BNO4 — CID 155793077
(2S,3R)-3-methyl-3-[3-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]pyrrolidine-2-carboxylic acid (PubChem CID 155793077) has the molecular formula C19H32BNO4 and a molecular weight of 349.28 g/mol. Its IUPAC name is (2S,3R)-3-methyl-3-[3-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S,3R)-3-methyl-3-[3-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 155793077 |
| Molecular Formula | C19H32BNO4 |
| Molecular Weight | 349.28 g/mol |
| Exact Mass | 349.24 |
| IUPAC Name | (2S,3R)-3-methyl-3-[3-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]pyrrolidine-2-carboxylic acid |
| SMILES | CC1(C)[C@H]2C[C@@H]3OB(CCC[C@]4(C)CCN[C@@H]4C(=O)O)O[C@]3(C)[C@@H]1C2 |
| InChI | InChI=1S/C19H32BNO4/c1-17(2)12-10-13(17)19(4)14(11-12)24-20(25-19)8-5-6-18(3)7-9-21-15(18)16(22)23/h12-15,21H,5-11H2,1-4H3,(H,22,23)/t12-,13-,14+,15-,18-,19-/m1/s1 |
| InChIKey | VLIKTDXPDXACJL-PHGIVBCJSA-N |
| XLogP | 2.95 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.28 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|