C16H25BO6S — CID 134903476
2-[2-[(2S,6R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethylsulfanyl]butanedioic acid (PubChem CID 134903476) has the molecular formula C16H25BO6S and a molecular weight of 356.25 g/mol. Its IUPAC name is 2-[2-[(2S,6R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethylsulfanyl]butanedioic acid.
| Compound Name | 2-[2-[(2S,6R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethylsulfanyl]butanedioic acid |
|---|---|
| PubChem CID | 134903476 |
| Molecular Formula | C16H25BO6S |
| Molecular Weight | 356.25 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 2-[2-[(2S,6R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethylsulfanyl]butanedioic acid |
| SMILES | CC1(C)C2CC1[C@]1(C)OB(CCSC(CC(=O)O)C(=O)O)O[C@@H]1C2 |
| InChI | InChI=1S/C16H25BO6S/c1-15(2)9-6-11(15)16(3)12(7-9)22-17(23-16)4-5-24-10(14(20)21)8-13(18)19/h9-12H,4-8H2,1-3H3,(H,18,19)(H,20,21)/t9?,10?,11?,12-,16+/m1/s1 |
| InChIKey | OALFVTOCVZHDDN-DBERZZTQSA-N |
| XLogP | 2.38 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.25 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|