C20H26BNO5 — CID 101129696
3-benzamido-3-[(2S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propanoic acid (PubChem CID 101129696) has the molecular formula C20H26BNO5 and a molecular weight of 371.24 g/mol. Its IUPAC name is 3-benzamido-3-[(2S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propanoic acid.
| Compound Name | 3-benzamido-3-[(2S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propanoic acid |
|---|---|
| PubChem CID | 101129696 |
| Molecular Formula | C20H26BNO5 |
| Molecular Weight | 371.24 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | 3-benzamido-3-[(2S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propanoic acid |
| SMILES | CC1(C)C2CC3OB(C(CC(=O)O)NC(=O)c4ccccc4)O[C@@]3(C)C1C2 |
| InChI | InChI=1S/C20H26BNO5/c1-19(2)13-9-14(19)20(3)15(10-13)26-21(27-20)16(11-17(23)24)22-18(25)12-7-5-4-6-8-12/h4-8,13-16H,9-11H2,1-3H3,(H,22,25)(H,23,24)/t13?,14?,15?,16?,20-/m0/s1 |
| InChIKey | DFEJKSOPGGQNCX-NURWUKSESA-N |
| XLogP | 2.53 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.24 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|