C13H23BClNO2 — CID 88912000
(1R)-N-chloro-1-[(2S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propan-1-amine (PubChem CID 88912000) has the molecular formula C13H23BClNO2 and a molecular weight of 271.60 g/mol. Its IUPAC name is (1R)-N-chloro-1-[(2S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propan-1-amine.
| Compound Name | (1R)-N-chloro-1-[(2S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propan-1-amine |
|---|---|
| PubChem CID | 88912000 |
| Molecular Formula | C13H23BClNO2 |
| Molecular Weight | 271.60 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | (1R)-N-chloro-1-[(2S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propan-1-amine |
| SMILES | CC[C@H](NCl)B1OC2CC3CC(C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C13H23BClNO2/c1-5-11(16-15)14-17-10-7-8-6-9(12(8,2)3)13(10,4)18-14/h8-11,16H,5-7H2,1-4H3/t8?,9?,10?,11-,13-/m0/s1 |
| InChIKey | VTFRNIPLPRYAFV-CITVPBLTSA-N |
| XLogP | 2.78 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.60 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|