C12H21BClNO2 — CID 90165197
(1R)-N-chloro-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethanamine (PubChem CID 90165197) has the molecular formula C12H21BClNO2 and a molecular weight of 257.57 g/mol. Its IUPAC name is (1R)-N-chloro-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethanamine.
| Compound Name | (1R)-N-chloro-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethanamine |
|---|---|
| PubChem CID | 90165197 |
| Molecular Formula | C12H21BClNO2 |
| Molecular Weight | 257.57 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | (1R)-N-chloro-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethanamine |
| SMILES | C[C@H](NCl)B1O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C12H21BClNO2/c1-7(15-14)13-16-10-6-8-5-9(11(8,2)3)12(10,4)17-13/h7-10,15H,5-6H2,1-4H3/t7-,8-,9-,10+,12-/m0/s1 |
| InChIKey | QUMYOGSRUOJGHL-GBVMLCMLSA-N |
| XLogP | 2.39 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.57 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|