C11H21BN2O2 — CID 149128780
[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]methanediamine (PubChem CID 149128780) has the molecular formula C11H21BN2O2 and a molecular weight of 224.11 g/mol. Its IUPAC name is [(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]methanediamine.
| Compound Name | [(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]methanediamine |
|---|---|
| PubChem CID | 149128780 |
| Molecular Formula | C11H21BN2O2 |
| Molecular Weight | 224.11 g/mol |
| Exact Mass | 224.17 |
| IUPAC Name | [(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]methanediamine |
| SMILES | CC1(C)[C@@H]2C[C@H]3OB(C(N)N)O[C@@]3(C)[C@H]1C2 |
| InChI | InChI=1S/C11H21BN2O2/c1-10(2)6-4-7(10)11(3)8(5-6)15-12(16-11)9(13)14/h6-9H,4-5,13-14H2,1-3H3/t6-,7-,8+,11-/m0/s1 |
| InChIKey | RBUCFECEVNENIV-SDCKUUTBSA-N |
| XLogP | 0.50 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.11 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|