C17H24BNO2 — CID 122130235
(S)-phenyl-[(2R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]methanamine (PubChem CID 122130235) has the molecular formula C17H24BNO2 and a molecular weight of 285.20 g/mol. Its IUPAC name is (S)-phenyl-[(2R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]methanamine.
| Compound Name | (S)-phenyl-[(2R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]methanamine |
|---|---|
| PubChem CID | 122130235 |
| Molecular Formula | C17H24BNO2 |
| Molecular Weight | 285.20 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | (S)-phenyl-[(2R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]methanamine |
| SMILES | CC1(C)C2CC3OB([C@H](N)c4ccccc4)O[C@]3(C)C1C2 |
| InChI | InChI=1S/C17H24BNO2/c1-16(2)12-9-13(16)17(3)14(10-12)20-18(21-17)15(19)11-7-5-4-6-8-11/h4-8,12-15H,9-10,19H2,1-3H3/t12?,13?,14?,15-,17-/m1/s1 |
| InChIKey | HMUQUMOKICGOKW-TXTUHRKBSA-N |
| XLogP | 2.95 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.20 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|