C27H35BN2O3 — CID 71562983
(2S)-2-amino-3-phenyl-N-[(2R)-2-phenyl-2-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]propanamide (PubChem CID 71562983) has the molecular formula C27H35BN2O3 and a molecular weight of 446.40 g/mol. Its IUPAC name is (2S)-2-amino-3-phenyl-N-[(2R)-2-phenyl-2-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]propanamide.
| Compound Name | (2S)-2-amino-3-phenyl-N-[(2R)-2-phenyl-2-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]propanamide |
|---|---|
| PubChem CID | 71562983 |
| Molecular Formula | C27H35BN2O3 |
| Molecular Weight | 446.40 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | (2S)-2-amino-3-phenyl-N-[(2R)-2-phenyl-2-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]propanamide |
| SMILES | CC1(C)[C@H]2C[C@@H]3OB([C@@H](CNC(=O)[C@@H](N)Cc4ccccc4)c4ccccc4)O[C@]3(C)[C@@H]1C2 |
| InChI | InChI=1S/C27H35BN2O3/c1-26(2)20-15-23(26)27(3)24(16-20)32-28(33-27)21(19-12-8-5-9-13-19)17-30-25(31)22(29)14-18-10-6-4-7-11-18/h4-13,20-24H,14-17,29H2,1-3H3,(H,30,31)/t20-,21+,22+,23-,24+,27-/m1/s1 |
| InChIKey | HZYMSUGIRDNACI-UMZLCMSCSA-N |
| XLogP | 3.72 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.40 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|