C25H41BClN5O3 — CID 71562604
(2S)-2-amino-5-(diaminomethylideneamino)-N-[(2R)-3-phenyl-2-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]pentanamide;hydrochloride (PubChem CID 71562604) has the molecular formula C25H41BClN5O3 and a molecular weight of 505.90 g/mol. Its IUPAC name is (2S)-2-amino-5-(diaminomethylideneamino)-N-[(2R)-3-phenyl-2-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]pentanamide;hydrochloride.
| Compound Name | (2S)-2-amino-5-(diaminomethylideneamino)-N-[(2R)-3-phenyl-2-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]pentanamide;hydrochloride |
|---|---|
| PubChem CID | 71562604 |
| Molecular Formula | C25H41BClN5O3 |
| Molecular Weight | 505.90 g/mol |
| Exact Mass | 505.30 |
| IUPAC Name | (2S)-2-amino-5-(diaminomethylideneamino)-N-[(2R)-3-phenyl-2-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]pentanamide;hydrochloride |
| SMILES | CC1(C)[C@H]2C[C@@H]3OB([C@@H](CNC(=O)[C@@H](N)CCCN=C(N)N)Cc4ccccc4)O[C@]3(C)[C@@H]1C2.Cl |
| InChI | InChI=1S/C25H40BN5O3.ClH/c1-24(2)17-13-20(24)25(3)21(14-17)33-26(34-25)18(12-16-8-5-4-6-9-16)15-31-22(32)19(27)10-7-11-30-23(28)29;/h4-6,8-9,17-21H,7,10-15,27H2,1-3H3,(H,31,32)(H4,28,29,30);1H/t17-,18-,19+,20-,21+,25-;/m1./s1 |
| InChIKey | KDXDOQRHOXYPJJ-OPIZLBHZSA-N |
| XLogP | 2.25 |
| TPSA | 137.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.90 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|