C26H42BN3O3 — CID 71562500
(2S)-2,6-diamino-N-[(2R)-4-phenyl-2-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]hexanamide (PubChem CID 71562500) has the molecular formula C26H42BN3O3 and a molecular weight of 455.45 g/mol. Its IUPAC name is (2S)-2,6-diamino-N-[(2R)-4-phenyl-2-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]hexanamide.
| Compound Name | (2S)-2,6-diamino-N-[(2R)-4-phenyl-2-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]hexanamide |
|---|---|
| PubChem CID | 71562500 |
| Molecular Formula | C26H42BN3O3 |
| Molecular Weight | 455.45 g/mol |
| Exact Mass | 455.33 |
| IUPAC Name | (2S)-2,6-diamino-N-[(2R)-4-phenyl-2-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]hexanamide |
| SMILES | CC1(C)[C@H]2C[C@@H]3OB([C@H](CCc4ccccc4)CNC(=O)[C@@H](N)CCCCN)O[C@]3(C)[C@@H]1C2 |
| InChI | InChI=1S/C26H42BN3O3/c1-25(2)19-15-22(25)26(3)23(16-19)32-27(33-26)20(13-12-18-9-5-4-6-10-18)17-30-24(31)21(29)11-7-8-14-28/h4-6,9-10,19-23H,7-8,11-17,28-29H2,1-3H3,(H,30,31)/t19-,20-,21+,22-,23+,26-/m1/s1 |
| InChIKey | NPUZZPNCBIKYGL-LDEFMAEZSA-N |
| XLogP | 3.29 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.45 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|