C26H40BN3O3 — CID 163954983
2-amino-6-(methylideneamino)-N-[3-phenyl-2-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)propyl]hexanamide (PubChem CID 163954983) has the molecular formula C26H40BN3O3 and a molecular weight of 453.44 g/mol. Its IUPAC name is 2-amino-6-(methylideneamino)-N-[3-phenyl-2-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)propyl]hexanamide.
| Compound Name | 2-amino-6-(methylideneamino)-N-[3-phenyl-2-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)propyl]hexanamide |
|---|---|
| PubChem CID | 163954983 |
| Molecular Formula | C26H40BN3O3 |
| Molecular Weight | 453.44 g/mol |
| Exact Mass | 453.32 |
| IUPAC Name | 2-amino-6-(methylideneamino)-N-[3-phenyl-2-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)propyl]hexanamide |
| SMILES | C=NCCCCC(N)C(=O)NCC(Cc1ccccc1)B1OC2CC3CC(C3(C)C)C2(C)O1 |
| InChI | InChI=1S/C26H40BN3O3/c1-25(2)19-15-22(25)26(3)23(16-19)32-27(33-26)20(14-18-10-6-5-7-11-18)17-30-24(31)21(28)12-8-9-13-29-4/h5-7,10-11,19-23H,4,8-9,12-17,28H2,1-3H3,(H,30,31) |
| InChIKey | SCOMYRZNJQRBAX-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.44 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|