C22H34BClN3O3- — CID 71566737
(2S)-2,6-diamino-N-[2-(2-methyl-3,5-dioxa-4-boratricyclo[5.1.1.02,6]nonan-4-yl)-3-phenylpropyl]hexanamide chloride (PubChem CID 71566737) has the molecular formula C22H34BClN3O3- and a molecular weight of 434.80 g/mol. Its IUPAC name is (2S)-2,6-diamino-N-[2-(2-methyl-3,5-dioxa-4-boratricyclo[5.1.1.02,6]nonan-4-yl)-3-phenylpropyl]hexanamide chloride.
| Compound Name | (2S)-2,6-diamino-N-[2-(2-methyl-3,5-dioxa-4-boratricyclo[5.1.1.02,6]nonan-4-yl)-3-phenylpropyl]hexanamide chloride |
|---|---|
| PubChem CID | 71566737 |
| Molecular Formula | C22H34BClN3O3- |
| Molecular Weight | 434.80 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | (2S)-2,6-diamino-N-[2-(2-methyl-3,5-dioxa-4-boratricyclo[5.1.1.02,6]nonan-4-yl)-3-phenylpropyl]hexanamide chloride |
| SMILES | CC12OB(C(CNC(=O)[C@@H](N)CCCCN)Cc3ccccc3)OC1C1CC2C1.[Cl-] |
| InChI | InChI=1S/C22H34BN3O3.ClH/c1-22-17-12-16(13-17)20(22)28-23(29-22)18(11-15-7-3-2-4-8-15)14-26-21(27)19(25)9-5-6-10-24;/h2-4,7-8,16-20H,5-6,9-14,24-25H2,1H3,(H,26,27);1H/p-1/t16?,17?,18?,19-,20?,22?;/m0./s1 |
| InChIKey | VLRIZZSRYJXUJO-XVBVVLDCSA-M |
| XLogP | -1.12 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.80 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|