C28H38BClN2O3 — CID 86576319
[(2S)-1-oxo-3-phenyl-1-[[3-phenyl-2-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]amino]propan-2-yl]azanium chloride (PubChem CID 86576319) has the molecular formula C28H38BClN2O3 and a molecular weight of 496.89 g/mol. Its IUPAC name is [(2S)-1-oxo-3-phenyl-1-[[3-phenyl-2-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]amino]propan-2-yl]azanium chloride.
| Compound Name | [(2S)-1-oxo-3-phenyl-1-[[3-phenyl-2-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]amino]propan-2-yl]azanium chloride |
|---|---|
| PubChem CID | 86576319 |
| Molecular Formula | C28H38BClN2O3 |
| Molecular Weight | 496.89 g/mol |
| Exact Mass | 496.27 |
| IUPAC Name | [(2S)-1-oxo-3-phenyl-1-[[3-phenyl-2-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]amino]propan-2-yl]azanium chloride |
| SMILES | CC1(C)[C@H]2C[C@@H]3OB(C(CNC(=O)[C@@H]([NH3+])Cc4ccccc4)Cc4ccccc4)O[C@]3(C)[C@@H]1C2.[Cl-] |
| InChI | InChI=1S/C28H37BN2O3.ClH/c1-27(2)21-16-24(27)28(3)25(17-21)33-29(34-28)22(14-19-10-6-4-7-11-19)18-31-26(32)23(30)15-20-12-8-5-9-13-20;/h4-13,21-25H,14-18,30H2,1-3H3,(H,31,32);1H/t21-,22?,23+,24-,25+,28-;/m1./s1 |
| InChIKey | WZHDXVGQYUFARY-BXRDAABVSA-N |
| XLogP | 0.30 |
| TPSA | 75.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.89 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|