C29H39BNO3+ — CID 159726600
[(2R,6S)-3-oxo-1,7-diphenyl-6-[(2R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]heptan-2-yl]azanium (PubChem CID 159726600) has the molecular formula C29H39BNO3+ and a molecular weight of 460.45 g/mol. Its IUPAC name is [(2R,6S)-3-oxo-1,7-diphenyl-6-[(2R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]heptan-2-yl]azanium.
| Compound Name | [(2R,6S)-3-oxo-1,7-diphenyl-6-[(2R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]heptan-2-yl]azanium |
|---|---|
| PubChem CID | 159726600 |
| Molecular Formula | C29H39BNO3+ |
| Molecular Weight | 460.45 g/mol |
| Exact Mass | 460.30 |
| IUPAC Name | [(2R,6S)-3-oxo-1,7-diphenyl-6-[(2R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]heptan-2-yl]azanium |
| SMILES | CC1(C)C2CC3OB([C@@H](CCC(=O)[C@H]([NH3+])Cc4ccccc4)Cc4ccccc4)O[C@]3(C)C1C2 |
| InChI | InChI=1S/C29H38BNO3/c1-28(2)22-18-26(28)29(3)27(19-22)33-30(34-29)23(16-20-10-6-4-7-11-20)14-15-25(32)24(31)17-21-12-8-5-9-13-21/h4-13,22-24,26-27H,14-19,31H2,1-3H3/p+1/t22?,23-,24+,26?,27?,29+/m0/s1 |
| InChIKey | NASFCSHHTWMTNC-KDQSNTTCSA-O |
| XLogP | 4.53 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.45 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|