C19H29BClNO2 — CID 164889520
3-phenyl-1-[(1S,2S,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propan-1-amine;hydrochloride (PubChem CID 164889520) has the molecular formula C19H29BClNO2 and a molecular weight of 349.71 g/mol. Its IUPAC name is 3-phenyl-1-[(1S,2S,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propan-1-amine;hydrochloride.
| Compound Name | 3-phenyl-1-[(1S,2S,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 164889520 |
| Molecular Formula | C19H29BClNO2 |
| Molecular Weight | 349.71 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | 3-phenyl-1-[(1S,2S,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propan-1-amine;hydrochloride |
| SMILES | CC1(C)[C@H]2C[C@@H]3OB(C(N)CCc4ccccc4)O[C@@]3(C)[C@H]1C2.Cl |
| InChI | InChI=1S/C19H28BNO2.ClH/c1-18(2)14-11-15(18)19(3)16(12-14)22-20(23-19)17(21)10-9-13-7-5-4-6-8-13;/h4-8,14-17H,9-12,21H2,1-3H3;1H/t14-,15+,16+,17?,19+;/m1./s1 |
| InChIKey | LDOJDRFKDPCKPS-DCMOVFIBSA-N |
| XLogP | 3.64 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.71 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|