C15H27BBrNO2 — CID 170836305
5-bromo-1-[(2S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pentan-1-amine (PubChem CID 170836305) has the molecular formula C15H27BBrNO2 and a molecular weight of 344.10 g/mol. Its IUPAC name is 5-bromo-1-[(2S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pentan-1-amine.
| Compound Name | 5-bromo-1-[(2S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pentan-1-amine |
|---|---|
| PubChem CID | 170836305 |
| Molecular Formula | C15H27BBrNO2 |
| Molecular Weight | 344.10 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 5-bromo-1-[(2S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pentan-1-amine |
| SMILES | CC1(C)C2CC3OB(C(N)CCCCBr)O[C@@]3(C)C1C2 |
| InChI | InChI=1S/C15H27BBrNO2/c1-14(2)10-8-11(14)15(3)12(9-10)19-16(20-15)13(18)6-4-5-7-17/h10-13H,4-9,18H2,1-3H3/t10?,11?,12?,13?,15-/m0/s1 |
| InChIKey | PVVJGTPJGQMPGM-YZXOMZRCSA-N |
| XLogP | 3.15 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.10 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|