C20H41BBrNO2Si2 — CID 10480015
(1R)-4-bromo-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]-N,N-bis(trimethylsilyl)butan-1-amine (PubChem CID 10480015) has the molecular formula C20H41BBrNO2Si2 and a molecular weight of 474.44 g/mol. Its IUPAC name is (1R)-4-bromo-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]-N,N-bis(trimethylsilyl)butan-1-amine.
| Compound Name | (1R)-4-bromo-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]-N,N-bis(trimethylsilyl)butan-1-amine |
|---|---|
| PubChem CID | 10480015 |
| Molecular Formula | C20H41BBrNO2Si2 |
| Molecular Weight | 474.44 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | (1R)-4-bromo-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]-N,N-bis(trimethylsilyl)butan-1-amine |
| SMILES | CC1(C)[C@@H]2C[C@H]3OB([C@H](CCCBr)N([Si](C)(C)C)[Si](C)(C)C)O[C@@]3(C)[C@H]1C2 |
| InChI | InChI=1S/C20H41BBrNO2Si2/c1-19(2)15-13-16(19)20(3)17(14-15)24-21(25-20)18(11-10-12-22)23(26(4,5)6)27(7,8)9/h15-18H,10-14H2,1-9H3/t15-,16-,17+,18-,20-/m0/s1 |
| InChIKey | FLKWOCSIXWRHAF-JNIAIEOXSA-N |
| XLogP | 5.77 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.44 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|