C21H44BNO2Si2 — CID 140553364
(1R)-3-methyl-1-[(1S,2S,6R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]-N,N-bis(trimethylsilyl)butan-1-amine (PubChem CID 140553364) has the molecular formula C21H44BNO2Si2 and a molecular weight of 409.57 g/mol. Its IUPAC name is (1R)-3-methyl-1-[(1S,2S,6R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]-N,N-bis(trimethylsilyl)butan-1-amine.
| Compound Name | (1R)-3-methyl-1-[(1S,2S,6R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]-N,N-bis(trimethylsilyl)butan-1-amine |
|---|---|
| PubChem CID | 140553364 |
| Molecular Formula | C21H44BNO2Si2 |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.30 |
| IUPAC Name | (1R)-3-methyl-1-[(1S,2S,6R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]-N,N-bis(trimethylsilyl)butan-1-amine |
| SMILES | CC(C)C[C@@H](B1O[C@@H]2CC3C[C@@H](C3(C)C)[C@]2(C)O1)N([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C21H44BNO2Si2/c1-15(2)12-19(23(26(6,7)8)27(9,10)11)22-24-18-14-16-13-17(20(16,3)4)21(18,5)25-22/h15-19H,12-14H2,1-11H3/t16?,17-,18+,19-,21-/m0/s1 |
| InChIKey | SJQWJOQKWFQPGE-SMVGOTRKSA-N |
| XLogP | 5.64 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|